Products 1781557-85-4

CAS 1781557-85-4 is the registry number for 4-Bromo-1,2-thiazole-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-bromo-1,2-thiazole-5-sulfonyl chloride (CAS 1781557-85-4) is a chemical compound with the molecular formula C3HBrClNO2S2 and a molecular weight of 262.5 g/mol. IUPAC name: 4-bromo-1,2-thiazole-5-sulfonyl chloride. InChIKey: KASDPSHEOCETRD-UHFFFAOYSA-N.

Identity
Molecular formulaC3HBrClNO2S2
Molecular weight262.5 g/mol
IUPAC name4-bromo-1,2-thiazole-5-sulfonyl chloride
InChIKeyKASDPSHEOCETRD-UHFFFAOYSA-N
SMILESC1=NSC(=C1Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)