Products 2228685-36-5

CAS 2228685-36-5 appears in our catalog under these names: 2-Bromo-4-thiazolesulfonyl chloride, 2-Bromothiazole-4-sulfonyl chloride, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 500mg, 1g, 250mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-bromo-1,3-thiazole-4-sulfonyl chloride (CAS 2228685-36-5) is a chemical compound with the molecular formula C3HBrClNO2S2 and a molecular weight of 262.5 g/mol. IUPAC name: 2-bromo-1,3-thiazole-4-sulfonyl chloride. InChIKey: FEHKOLVCXPPORT-UHFFFAOYSA-N.

Identity
Molecular formulaC3HBrClNO2S2
Molecular weight262.5 g/mol
IUPAC name2-bromo-1,3-thiazole-4-sulfonyl chloride
InChIKeyFEHKOLVCXPPORT-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)