CAS 1781862-68-7 is the registry number for 2-Bromo-benzo(b)thiophene-7-ol. Offered by: TRC. Available pack sizes: 100mg.
2-bromo-1-benzothiophen-7-ol (CAS 1781862-68-7) is a chemical compound with the molecular formula C8H5BrOS and a molecular weight of 229.10 g/mol. IUPAC name: 2-bromo-1-benzothiophen-7-ol. InChIKey: LZBATWDUIKQDFT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrOS |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 2-bromo-1-benzothiophen-7-ol |
| InChIKey | LZBATWDUIKQDFT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)SC(=C2)Br |
Computed by PubChem (NCBI)