Products 72002-05-2
CAS 72002-05-2 is the registry number for Benzo[b]thiophen-3(2H)-one, 7-bromo-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-bromo-1-benzothiophen-3-one (CAS 72002-05-2) is a chemical compound with the molecular formula C8H5BrOS and a molecular weight of 229.10 g/mol. IUPAC name: 7-bromo-1-benzothiophen-3-one. InChIKey: UHBOWTAECPTWGL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrOS |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 7-bromo-1-benzothiophen-3-one |
| InChIKey | UHBOWTAECPTWGL-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(S1)C(=CC=C2)Br |
Computed by PubChem (NCBI)