CAS 1782074-61-6 is the registry number for 3,6–di(furan–2–yl)–9H–carbazole. Offered by: GLPBio. Available pack sizes: 1g, 200mg.
3,6-bis(furan-2-yl)-9H-carbazole (CAS 1782074-61-6) is a chemical compound with the molecular formula C20H13NO2 and a molecular weight of 299.3 g/mol. IUPAC name: 3,6-bis(furan-2-yl)-9H-carbazole. InChIKey: YPYIESORSNBJHB-UHFFFAOYSA-N.
| Molecular formula | C20H13NO2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 3,6-bis(furan-2-yl)-9H-carbazole |
| InChIKey | YPYIESORSNBJHB-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC3=C(C=C2)NC4=C3C=C(C=C4)C5=CC=CO5 |
Computed by PubChem (NCBI)