Products 1782312-69-9

CAS 1782312-69-9 appears in our catalog under these names: 2-Cyclopropyl-2-methoxyethane-1-sulfonyl chloride, 95%, 2-Cyclopropyl-2-methoxyethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-cyclopropyl-2-methoxyethanesulfonyl chloride (CAS 1782312-69-9) is a chemical compound with the molecular formula C6H11ClO3S and a molecular weight of 198.67 g/mol. IUPAC name: 2-cyclopropyl-2-methoxyethanesulfonyl chloride. InChIKey: GMEYYKNUPPSKLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClO3S
Molecular weight198.67 g/mol
IUPAC name2-cyclopropyl-2-methoxyethanesulfonyl chloride
InChIKeyGMEYYKNUPPSKLQ-UHFFFAOYSA-N
SMILESCOC(CS(=O)(=O)Cl)C1CC1

Computed by PubChem (NCBI)