Products 264608-29-9

CAS 264608-29-9 appears in our catalog under these names: (Tetrahydro-2H-pyran-4-yl)methanesulfonyl chloride, 95%, (Tetrahydro-2H-pyran-4-yl)methanesulfonyl chloride 98%, (Tetrahydro-2H-pyran-4-yl)methanesulfonyl chloride, 98%, 98%, (Tetrahydro-2H-pyran-4-yl)methanesulfonyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.

Structural formula: {0} (CAS {1})

Oxan-4-ylmethanesulfonyl chloride (CAS 264608-29-9) is a chemical compound with the molecular formula C6H11ClO3S and a molecular weight of 198.67 g/mol. IUPAC name: oxan-4-ylmethanesulfonyl chloride. InChIKey: AFFJSWVSULCYLG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClO3S
Molecular weight198.67 g/mol
IUPAC nameoxan-4-ylmethanesulfonyl chloride
InChIKeyAFFJSWVSULCYLG-UHFFFAOYSA-N
SMILESC1COCCC1CS(=O)(=O)Cl

Computed by PubChem (NCBI)