CAS 1782408-09-6 is the registry number for 4-(4-Bromopyrazol-1-yl)-1$l^{6}-thiane-1,1-dione, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-bromopyrazol-1-yl)thiane 1,1-dioxide (CAS 1782408-09-6) is a chemical compound with the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. IUPAC name: 4-(4-bromopyrazol-1-yl)thiane 1,1-dioxide. InChIKey: VWXKUVNQVOUBBA-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2S |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 4-(4-bromopyrazol-1-yl)thiane 1,1-dioxide |
| InChIKey | VWXKUVNQVOUBBA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C=C(C=N2)Br |
Computed by PubChem (NCBI)