CAS 349540-50-7 is the registry number for ((2-Bromophenyl)sulfamoyl)dimethylamine. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg.
1-bromo-2-(dimethylsulfamoylamino)benzene (CAS 349540-50-7) is a chemical compound with the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. IUPAC name: 1-bromo-2-(dimethylsulfamoylamino)benzene. InChIKey: UCJZXZTXNXADJL-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2S |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 1-bromo-2-(dimethylsulfamoylamino)benzene |
| InChIKey | UCJZXZTXNXADJL-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC1=CC=CC=C1Br |
Computed by PubChem (NCBI)