Products 1782774-05-3
CAS 1782774-05-3 appears in our catalog under these names: 3-Bromo-5-fluoro-2-isopropoxybenzoic acid, 3-Bromo-5-fluoro-2-isopropoxybenzoic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
3-bromo-5-fluoro-2-propan-2-yloxybenzoic acid (CAS 1782774-05-3) is a chemical compound with the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. IUPAC name: 3-bromo-5-fluoro-2-propan-2-yloxybenzoic acid. InChIKey: JIZXMPMMDIRVEZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO3 |
|---|---|
| Molecular weight | 277.09 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-propan-2-yloxybenzoic acid |
| InChIKey | JIZXMPMMDIRVEZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)F)C(=O)O |
Computed by PubChem (NCBI)