CAS 2112625-68-8 is the registry number for Ethyl 5-bromo-2-fluoro-3-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 5-bromo-2-fluoro-3-methoxybenzoate (CAS 2112625-68-8) is a chemical compound with the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. IUPAC name: ethyl 5-bromo-2-fluoro-3-methoxybenzoate. InChIKey: ACHUFXCDGBCEAI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO3 |
|---|---|
| Molecular weight | 277.09 g/mol |
| IUPAC name | ethyl 5-bromo-2-fluoro-3-methoxybenzoate |
| InChIKey | ACHUFXCDGBCEAI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Br)OC)F |
Computed by PubChem (NCBI)