CAS 1783318-15-9 appears in our catalog under these names: 8-Bromopyrazolo(1,5-a)(1,3,5)triazine-2,4-diamine, 95%, 8-Bromopyrazolo(1,5-a)(1,3,5)triazine-2,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
8-bromopyrazolo[1,5-a][1,3,5]triazine-2,4-diamine (CAS 1783318-15-9) is a chemical compound with the molecular formula C5H5BrN6 and a molecular weight of 229.04 g/mol. IUPAC name: 8-bromopyrazolo[1,5-a][1,3,5]triazine-2,4-diamine. InChIKey: YPWPLWLTSDXLOM-UHFFFAOYSA-N.
| Molecular formula | C5H5BrN6 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | 8-bromopyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
| InChIKey | YPWPLWLTSDXLOM-UHFFFAOYSA-N |
| SMILES | C1=NN2C(=C1Br)N=C(N=C2N)N |
Computed by PubChem (NCBI)