CAS 885878-34-2 is the registry number for 8-Bromo-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine (CAS 885878-34-2) is a chemical compound with the molecular formula C5H5BrN6 and a molecular weight of 229.04 g/mol. IUPAC name: 8-bromo-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine. InChIKey: ZDOIVGQYISHAJV-UHFFFAOYSA-N.
| Molecular formula | C5H5BrN6 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | 8-bromo-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
| InChIKey | ZDOIVGQYISHAJV-UHFFFAOYSA-N |
| SMILES | C1=NN2C(=N1)C(=C(N=C2N)N)Br |
Computed by PubChem (NCBI)