CAS 1783353-90-1 is the registry number for 2-(4-(1,1-difluoroethyl)phenyl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(1,1-difluoroethyl)phenyl]propan-2-ol (CAS 1783353-90-1) is a chemical compound with the molecular formula C11H14F2O and a molecular weight of 200.22 g/mol. IUPAC name: 2-[4-(1,1-difluoroethyl)phenyl]propan-2-ol. InChIKey: XAMHELFHEPHZNK-UHFFFAOYSA-N.
| Molecular formula | C11H14F2O |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-[4-(1,1-difluoroethyl)phenyl]propan-2-ol |
| InChIKey | XAMHELFHEPHZNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(C)(F)F)O |
Computed by PubChem (NCBI)