Products 1895405-54-5
CAS 1895405-54-5 appears in our catalog under these names: 2–(2，4，6–trimethylphenyl)–2，2–difluoroethan–1–ol, 2,2-difluoro-2-(2,4,6-trimethylphenyl)ethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2,2-difluoro-2-(2,4,6-trimethylphenyl)ethanol (CAS 1895405-54-5) is a chemical compound with the molecular formula C11H14F2O and a molecular weight of 200.22 g/mol. IUPAC name: 2,2-difluoro-2-(2,4,6-trimethylphenyl)ethanol. InChIKey: NEZMHRDKPCBSTB-UHFFFAOYSA-N.
| Molecular formula | C11H14F2O |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2,2-difluoro-2-(2,4,6-trimethylphenyl)ethanol |
| InChIKey | NEZMHRDKPCBSTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(CO)(F)F)C |
Computed by PubChem (NCBI)