CAS 17834-04-7 appears in our catalog under these names: 8-Hydroxy Warfarin, 8-Hydroxywarfarin. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 1mg, 25mg, 5mg.
4,8-dihydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one (CAS 17834-04-7) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 324.3 g/mol. IUPAC name: 4,8-dihydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one. InChIKey: BHBOXPNWDGYJNB-UHFFFAOYSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 4,8-dihydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
| InChIKey | BHBOXPNWDGYJNB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=C(C(=CC=C3)O)OC2=O)O |
Computed by PubChem (NCBI)