CAS 94820-66-3 is the registry number for 8-Hydroxy Warfarin-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
4,8-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one (CAS 94820-66-3) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 329.4 g/mol. IUPAC name: 4,8-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one. InChIKey: BHBOXPNWDGYJNB-QRKCWBMQSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4,8-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| InChIKey | BHBOXPNWDGYJNB-QRKCWBMQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CC(=O)C)C2=C(C3=C(C(=CC=C3)O)OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)