Products 1783542-18-6
CAS 1783542-18-6 is the registry number for (6-Bromo-2,3-dihydro-1H-inden-4-yl)methanol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(6-bromo-2,3-dihydro-1H-inden-4-yl)methanol (CAS 1783542-18-6) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: (6-bromo-2,3-dihydro-1H-inden-4-yl)methanol. InChIKey: DZESJBOLKDWJJV-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | (6-bromo-2,3-dihydro-1H-inden-4-yl)methanol |
| InChIKey | DZESJBOLKDWJJV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC(=C2)Br)CO |
Computed by PubChem (NCBI)