CAS 178374-44-2 appears in our catalog under these names: 2',3'-Dideoxy-3'-fluoro-a-uridine, 2',3'-Dideoxy-3'-fluoro-alpha-uridine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2g, 1g, 5g, 25g, 10g, 250mg.
1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 178374-44-2) is a chemical compound with the molecular formula C9H11FN2O4 and a molecular weight of 230.19 g/mol. IUPAC name: 1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: BKIUEHLYJFLWPK-BBVRLYRLSA-N.
| Molecular formula | C9H11FN2O4 |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | BKIUEHLYJFLWPK-BBVRLYRLSA-N |
| SMILES | C1[C@@H]([C@H](O[C@@H]1N2C=CC(=O)NC2=O)CO)F |
Computed by PubChem (NCBI)