CAS 41107-56-6 appears in our catalog under these names: 2',3'-Dideoxy-3'-fluorouridine, 2′,3′-Dideoxy-3′-fluorouridine, 97%, 2′,3′–Dideoxy–3′–fluorouridine, 2’,3’-Dideoxy-3’-fluorouridine, ≥95%, ≥95%, 2′,3′-Dideoxy-3′-fluorouridine. Offered by: TRC, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 10mg, 5mg, 25mg, 50mg, 5 mg, 25 mg.
1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 41107-56-6) is a chemical compound with the molecular formula C9H11FN2O4 and a molecular weight of 230.19 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: BKIUEHLYJFLWPK-SHYZEUOFSA-N.
| Molecular formula | C9H11FN2O4 |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | BKIUEHLYJFLWPK-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)F |
Computed by PubChem (NCBI)