CAS 1784001-90-6 appears in our catalog under these names: 7-Fluoro-1,3-benzothiazole-2-carbaldehyde, 95%, 7-Fluoro-1,3-benzothiazole-2-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-fluoro-1,3-benzothiazole-2-carbaldehyde (CAS 1784001-90-6) is a chemical compound with the molecular formula C8H4FNOS and a molecular weight of 181.19 g/mol. IUPAC name: 7-fluoro-1,3-benzothiazole-2-carbaldehyde. InChIKey: FROUTQVGDBLQRG-UHFFFAOYSA-N.
| Molecular formula | C8H4FNOS |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 7-fluoro-1,3-benzothiazole-2-carbaldehyde |
| InChIKey | FROUTQVGDBLQRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC(=N2)C=O |
Computed by PubChem (NCBI)