CAS 73945-65-0 is the registry number for 2-Fluorobenzoyl isothiocyanate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-fluorobenzoyl isothiocyanate (CAS 73945-65-0) is a chemical compound with the molecular formula C8H4FNOS and a molecular weight of 181.19 g/mol. IUPAC name: 2-fluorobenzoyl isothiocyanate. InChIKey: SPRXMLIDSAYUFL-UHFFFAOYSA-N.
| Molecular formula | C8H4FNOS |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-fluorobenzoyl isothiocyanate |
| InChIKey | SPRXMLIDSAYUFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N=C=S)F |
Computed by PubChem (NCBI)