CAS 178402-36-3 is the registry number for 3-(3-Fluorophenyl)-5,5-dimethyl-4-(4-(methylsulfonyl)phenyl)-2(5H)-furanone. Offered by: TRC. Available pack sizes: 250mg.
3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (CAS 178402-36-3) is a chemical compound with the molecular formula C19H17FO4S and a molecular weight of 360.4 g/mol. IUPAC name: 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one. InChIKey: NXERGIJHYVUXHM-UHFFFAOYSA-N.
| Molecular formula | C19H17FO4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| InChIKey | NXERGIJHYVUXHM-UHFFFAOYSA-N |
| SMILES | CC1(C(=C(C(=O)O1)C2=CC(=CC=C2)F)C3=CC=C(C=C3)S(=O)(=O)C)C |
Computed by PubChem (NCBI)