CAS 301690-25-5 is the registry number for Polmacoxib Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (CAS 301690-25-5) is a chemical compound with the molecular formula C19H17FO4S and a molecular weight of 360.4 g/mol. IUPAC name: 4-(3-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one. InChIKey: SLDVCDFNTJZEEB-UHFFFAOYSA-N.
| Molecular formula | C19H17FO4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| InChIKey | SLDVCDFNTJZEEB-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C(=C(O1)C2=CC=C(C=C2)S(=O)(=O)C)C3=CC(=CC=C3)F)C |
Computed by PubChem (NCBI)