CAS 1784429-31-7 is the registry number for 2-Chloro-5-fluoro-4-nitropyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-5-fluoro-4-nitropyridine (CAS 1784429-31-7) is a chemical compound with the molecular formula C5H2ClFN2O2 and a molecular weight of 176.53 g/mol. IUPAC name: 2-chloro-5-fluoro-4-nitropyridine. InChIKey: YTVIFRUTAIUPNR-UHFFFAOYSA-N.
| Molecular formula | C5H2ClFN2O2 |
|---|---|
| Molecular weight | 176.53 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-nitropyridine |
| InChIKey | YTVIFRUTAIUPNR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)