Products 1256785-64-4
CAS 1256785-64-4 appears in our catalog under these names: 6-Chloro-5-fluoropyrimidine-4-carboxylic acid, 97%, 6-Chloro-5-fluoropyrimidine-4-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg.
6-chloro-5-fluoropyrimidine-4-carboxylic acid (CAS 1256785-64-4) is a chemical compound with the molecular formula C5H2ClFN2O2 and a molecular weight of 176.53 g/mol. IUPAC name: 6-chloro-5-fluoropyrimidine-4-carboxylic acid. InChIKey: CTMKNADCFBTSHO-UHFFFAOYSA-N.
| Molecular formula | C5H2ClFN2O2 |
|---|---|
| Molecular weight | 176.53 g/mol |
| IUPAC name | 6-chloro-5-fluoropyrimidine-4-carboxylic acid |
| InChIKey | CTMKNADCFBTSHO-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)Cl)F)C(=O)O |
Computed by PubChem (NCBI)