CAS 333998-12-2 appears in our catalog under these names: 2–Chloro–6–fluoro–3–nitropyridine, 2-Chloro-6-fluoro-3-nitropyridine, 95%, 2-Chloro-6-fluoro-3-nitropyridine 95%, 2-Chloro-6-fluoro-3-nitropyridine, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g, 50mg.
2-chloro-6-fluoro-3-nitropyridine (CAS 333998-12-2) is a chemical compound with the molecular formula C5H2ClFN2O2 and a molecular weight of 176.53 g/mol. IUPAC name: 2-chloro-6-fluoro-3-nitropyridine. InChIKey: SBLKLWBROBWDAO-UHFFFAOYSA-N.
| Molecular formula | C5H2ClFN2O2 |
|---|---|
| Molecular weight | 176.53 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-nitropyridine |
| InChIKey | SBLKLWBROBWDAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)