CAS 1784468-46-7 is the registry number for tert-butyl 3-amino-3-(difluoromethyl)azetidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl 3-amino-3-(difluoromethyl)azetidine-1-carboxylate (CAS 1784468-46-7) is a chemical compound with the molecular formula C9H16F2N2O2 and a molecular weight of 222.23 g/mol. IUPAC name: tert-butyl 3-amino-3-(difluoromethyl)azetidine-1-carboxylate. InChIKey: XCCNQCXPGSQACR-UHFFFAOYSA-N.
| Molecular formula | C9H16F2N2O2 |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(difluoromethyl)azetidine-1-carboxylate |
| InChIKey | XCCNQCXPGSQACR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(F)F)N |
Computed by PubChem (NCBI)