CAS 1784748-09-9 is the registry number for Rel-(3R,4S)-4-(3,5-difluoropyridin-4-yl)-2-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-(3,5-difluoro-4-pyridinyl)-2-oxopyrrolidine-3-carboxylic acid (CAS 1784748-09-9) is a chemical compound with the molecular formula C10H8F2N2O3 and a molecular weight of 242.18 g/mol. IUPAC name: (3R,4S)-4-(3,5-difluoro-4-pyridinyl)-2-oxopyrrolidine-3-carboxylic acid. InChIKey: MZJSONMXPLAKGS-SPGJFGJESA-N.
| Molecular formula | C10H8F2N2O3 |
|---|---|
| Molecular weight | 242.18 g/mol |
| IUPAC name | (3R,4S)-4-(3,5-difluoro-4-pyridinyl)-2-oxopyrrolidine-3-carboxylic acid |
| InChIKey | MZJSONMXPLAKGS-SPGJFGJESA-N |
| SMILES | C1[C@@H]([C@H](C(=O)N1)C(=O)O)C2=C(C=NC=C2F)F |
Computed by PubChem (NCBI)