CAS 2663808-23-7 is the registry number for 5-(2,6-Difluoro-4-methoxyphenyl)imidazolidine-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,6-difluoro-4-methoxyphenyl)imidazolidine-2,4-dione (CAS 2663808-23-7) is a chemical compound with the molecular formula C10H8F2N2O3 and a molecular weight of 242.18 g/mol. IUPAC name: 5-(2,6-difluoro-4-methoxyphenyl)imidazolidine-2,4-dione. InChIKey: BTGHIFUJBRPJRC-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O3 |
|---|---|
| Molecular weight | 242.18 g/mol |
| IUPAC name | 5-(2,6-difluoro-4-methoxyphenyl)imidazolidine-2,4-dione |
| InChIKey | BTGHIFUJBRPJRC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C2C(=O)NC(=O)N2)F |
Computed by PubChem (NCBI)