Products 1784905-62-9

CAS 1784905-62-9 is the registry number for 3-Chloro-2-methoxy-4-methylbenzyl alcohol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3-chloro-2-methoxy-4-methylphenyl)methanol (CAS 1784905-62-9) is a chemical compound with the molecular formula C9H11ClO2 and a molecular weight of 186.63 g/mol. IUPAC name: (3-chloro-2-methoxy-4-methylphenyl)methanol. InChIKey: PXVNMPGQUVLTBC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO2
Molecular weight186.63 g/mol
IUPAC name(3-chloro-2-methoxy-4-methylphenyl)methanol
InChIKeyPXVNMPGQUVLTBC-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)CO)OC)Cl

Computed by PubChem (NCBI)