Products 1785241-52-2
CAS 1785241-52-2 is the registry number for 2-(aminomethyl)-4-chloro-3,5-difluoro-phenol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(aminomethyl)-4-chloro-3,5-difluorophenol (CAS 1785241-52-2) is a chemical compound with the molecular formula C7H6ClF2NO and a molecular weight of 193.58 g/mol. IUPAC name: 2-(aminomethyl)-4-chloro-3,5-difluorophenol. InChIKey: LULGKEZAQKUUHD-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF2NO |
|---|---|
| Molecular weight | 193.58 g/mol |
| IUPAC name | 2-(aminomethyl)-4-chloro-3,5-difluorophenol |
| InChIKey | LULGKEZAQKUUHD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)F)CN)O |
Computed by PubChem (NCBI)