Products 1785298-56-7
CAS 1785298-56-7 is the registry number for 2-{1-((tert-Butoxy)carbonyl)-3-hydroxypiperidin-3-yl}-2,2-difluoroacetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-difluoro-2-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]acetic acid (CAS 1785298-56-7) is a chemical compound with the molecular formula C12H19F2NO5 and a molecular weight of 295.28 g/mol. IUPAC name: 2,2-difluoro-2-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]acetic acid. InChIKey: NCKJKVTXWCIBPC-UHFFFAOYSA-N.
| Molecular formula | C12H19F2NO5 |
|---|---|
| Molecular weight | 295.28 g/mol |
| IUPAC name | 2,2-difluoro-2-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]acetic acid |
| InChIKey | NCKJKVTXWCIBPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(C(C(=O)O)(F)F)O |
Computed by PubChem (NCBI)