CAS 1807916-61-5 is the registry number for 1-tert-Butyl 2-methyl (2R,4S)-4-(difluoromethoxy)pyrrolidine-1,2-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-(difluoromethoxy)pyrrolidine-1,2-dicarboxylate (CAS 1807916-61-5) is a chemical compound with the molecular formula C12H19F2NO5 and a molecular weight of 295.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-(difluoromethoxy)pyrrolidine-1,2-dicarboxylate. InChIKey: YMBKIBFMXIQAEU-JGVFFNPUSA-N.
| Molecular formula | C12H19F2NO5 |
|---|---|
| Molecular weight | 295.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-(difluoromethoxy)pyrrolidine-1,2-dicarboxylate |
| InChIKey | YMBKIBFMXIQAEU-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)OC(F)F |
Computed by PubChem (NCBI)