CAS 1785299-83-3 appears in our catalog under these names: 4-Bromo-2-chloro-3,5-difluoro-phenol, 90%, 4-Bromo-2-chloro-3,5-difluorophenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-bromo-2-chloro-3,5-difluorophenol (CAS 1785299-83-3) is a chemical compound with the molecular formula C6H2BrClF2O and a molecular weight of 243.43 g/mol. IUPAC name: 4-bromo-2-chloro-3,5-difluorophenol. InChIKey: LAYKVOQCNKPBQS-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O |
|---|---|
| Molecular weight | 243.43 g/mol |
| IUPAC name | 4-bromo-2-chloro-3,5-difluorophenol |
| InChIKey | LAYKVOQCNKPBQS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)Cl)O |
Computed by PubChem (NCBI)