CAS 1879026-18-2 is the registry number for 5-Bromo-4-chloro-2,3-difluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-4-chloro-2,3-difluorophenol (CAS 1879026-18-2) is a chemical compound with the molecular formula C6H2BrClF2O and a molecular weight of 243.43 g/mol. IUPAC name: 5-bromo-4-chloro-2,3-difluorophenol. InChIKey: HPEBHWGCBOBNRZ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O |
|---|---|
| Molecular weight | 243.43 g/mol |
| IUPAC name | 5-bromo-4-chloro-2,3-difluorophenol |
| InChIKey | HPEBHWGCBOBNRZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)F)F)O |
Computed by PubChem (NCBI)