Products 1785345-23-4
CAS 1785345-23-4 is the registry number for 1-(2-Amino-4-fluorophenyl)-2,2,2-trifluoroethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-amino-4-fluorophenyl)-2,2,2-trifluoroethanol (CAS 1785345-23-4) is a chemical compound with the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. IUPAC name: 1-(2-amino-4-fluorophenyl)-2,2,2-trifluoroethanol. InChIKey: FQROFFSCOIERCX-UHFFFAOYSA-N.
| Molecular formula | C8H7F4NO |
|---|---|
| Molecular weight | 209.14 g/mol |
| IUPAC name | 1-(2-amino-4-fluorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | FQROFFSCOIERCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)C(C(F)(F)F)O |
Computed by PubChem (NCBI)