CAS 1785350-84-6 appears in our catalog under these names: 2,3,4-Trifluoro-6-methoxybenzaldehyde, 95%, 6-Methoxy-2,3,4-trifluorobenzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,3,4-trifluoro-6-methoxybenzaldehyde (CAS 1785350-84-6) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,3,4-trifluoro-6-methoxybenzaldehyde. InChIKey: WBFUNWUIACVBSM-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2,3,4-trifluoro-6-methoxybenzaldehyde |
| InChIKey | WBFUNWUIACVBSM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1C=O)F)F)F |
Computed by PubChem (NCBI)