Products 1785366-02-0

CAS 1785366-02-0 is the registry number for Ethyl 1–amino–3–((benzyloxy)methyl)cyclobutane–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-amino-3-(phenylmethoxymethyl)cyclobutane-1-carboxylate (CAS 1785366-02-0) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: ethyl 1-amino-3-(phenylmethoxymethyl)cyclobutane-1-carboxylate. InChIKey: CHSCSXLMFNHJOY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21NO3
Molecular weight263.33 g/mol
IUPAC nameethyl 1-amino-3-(phenylmethoxymethyl)cyclobutane-1-carboxylate
InChIKeyCHSCSXLMFNHJOY-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC(C1)COCC2=CC=CC=C2)N

Computed by PubChem (NCBI)