CAS 178672-23-6 appears in our catalog under these names: 2-Amino-N,N,5-trimethylbenzamide, 95%, 2-Amino-N,N,5-trimethylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-amino-N,N,5-trimethylbenzamide (CAS 178672-23-6) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 2-amino-N,N,5-trimethylbenzamide. InChIKey: ZJSZIIIESSNAIO-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-amino-N,N,5-trimethylbenzamide |
| InChIKey | ZJSZIIIESSNAIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C(=O)N(C)C |
Computed by PubChem (NCBI)