CAS 178676-65-8 appears in our catalog under these names: Agomelatine Impurity 43, (E)-(3,4-Dihydro-7-methoxy-1(2H)-naphthalenylidene)acetonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 25mg, 50mg.
(2E)-2-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile (CAS 178676-65-8) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: (2E)-2-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile. InChIKey: SWTIDKZDGAFNSA-YRNVUSSQSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | (2E)-2-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)acetonitrile |
| InChIKey | SWTIDKZDGAFNSA-YRNVUSSQSA-N |
| SMILES | COC1=CC\2=C(CCC/C2=C\C#N)C=C1 |
Computed by PubChem (NCBI)