CAS 178685-07-9 is the registry number for 3-TrifluoromethylphenEthyl iodide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2-iodoethyl)-3-(trifluoromethyl)benzene (CAS 178685-07-9) is a chemical compound with the molecular formula C9H8F3I and a molecular weight of 300.06 g/mol. IUPAC name: 1-(2-iodoethyl)-3-(trifluoromethyl)benzene. InChIKey: SLCGTIAFUDSGME-UHFFFAOYSA-N.
| Molecular formula | C9H8F3I |
|---|---|
| Molecular weight | 300.06 g/mol |
| IUPAC name | 1-(2-iodoethyl)-3-(trifluoromethyl)benzene |
| InChIKey | SLCGTIAFUDSGME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCI |
Computed by PubChem (NCBI)