CAS 875550-67-7 is the registry number for 2-Iodo-1,3-dimethyl-5-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-1,3-dimethyl-5-(trifluoromethyl)benzene (CAS 875550-67-7) is a chemical compound with the molecular formula C9H8F3I and a molecular weight of 300.06 g/mol. IUPAC name: 2-iodo-1,3-dimethyl-5-(trifluoromethyl)benzene. InChIKey: JAMMGMLRMGHXNY-UHFFFAOYSA-N.
| Molecular formula | C9H8F3I |
|---|---|
| Molecular weight | 300.06 g/mol |
| IUPAC name | 2-iodo-1,3-dimethyl-5-(trifluoromethyl)benzene |
| InChIKey | JAMMGMLRMGHXNY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1I)C)C(F)(F)F |
Computed by PubChem (NCBI)