CAS 178758-80-0 is the registry number for 3-(5-Amino-1-pentanoyl)pyridine Dihydrochloride. Offered by: TRC. Available pack sizes: 1g.
5-amino-1-pyridin-3-ylpentan-1-one;dihydrochloride (CAS 178758-80-0) is a chemical compound with the molecular formula C10H16Cl2N2O and a molecular weight of 251.15 g/mol. IUPAC name: 5-amino-1-pyridin-3-ylpentan-1-one;dihydrochloride. InChIKey: NFLPKFRYMIEKOM-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O |
|---|---|
| Molecular weight | 251.15 g/mol |
| IUPAC name | 5-amino-1-pyridin-3-ylpentan-1-one;dihydrochloride |
| InChIKey | NFLPKFRYMIEKOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)CCCCN.Cl.Cl |
Computed by PubChem (NCBI)