Products 2169997-55-9

CAS 2169997-55-9 is the registry number for 4-(4-Piperidinyl)-2(1h)-pyridinone dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-piperidin-4-yl-1H-pyridin-2-one;dihydrochloride (CAS 2169997-55-9) is a chemical compound with the molecular formula C10H16Cl2N2O and a molecular weight of 251.15 g/mol. IUPAC name: 4-piperidin-4-yl-1H-pyridin-2-one;dihydrochloride. InChIKey: PPOWJSWKPCEYRE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16Cl2N2O
Molecular weight251.15 g/mol
IUPAC name4-piperidin-4-yl-1H-pyridin-2-one;dihydrochloride
InChIKeyPPOWJSWKPCEYRE-UHFFFAOYSA-N
SMILESC1CNCCC1C2=CC(=O)NC=C2.Cl.Cl

Computed by PubChem (NCBI)