Products 1787855-34-8

CAS 1787855-34-8 is the registry number for 7,7-Dimethyl-1,4-thiazepane 1,1-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

7,7-dimethyl-1,4-thiazepane 1,1-dioxide;hydrochloride (CAS 1787855-34-8) is a chemical compound with the molecular formula C7H16ClNO2S and a molecular weight of 213.73 g/mol. IUPAC name: 7,7-dimethyl-1,4-thiazepane 1,1-dioxide;hydrochloride. InChIKey: SKRLWGMYVOOHPM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16ClNO2S
Molecular weight213.73 g/mol
IUPAC name7,7-dimethyl-1,4-thiazepane 1,1-dioxide;hydrochloride
InChIKeySKRLWGMYVOOHPM-UHFFFAOYSA-N
SMILESCC1(CCNCCS1(=O)=O)C.Cl

Computed by PubChem (NCBI)