CAS 1788041-66-6 appears in our catalog under these names: 2-Methylindazole-3,7-dicarbaldehyde, 95%, 2-Methyl-2H-indazole-3,7-dicarbaldehyde, 98%, 98%, 2-METHYL-2H-INDAZOLE-3,7-DICARBALDEHYDE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-methylindazole-3,7-dicarbaldehyde (CAS 1788041-66-6) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2-methylindazole-3,7-dicarbaldehyde. InChIKey: GETAPNQYTGJFKR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-methylindazole-3,7-dicarbaldehyde |
| InChIKey | GETAPNQYTGJFKR-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=CC=C(C2=N1)C=O)C=O |
Computed by PubChem (NCBI)