CAS 1788044-02-9 appears in our catalog under these names: (1H-Benzo[d]imidazol-4-yl)methanamine hydrochloride, 95%, (1H-Benzo(d)imidazol-4-yl)methanamine hydrochloride, 97%, 1H-Benzimidazole-7-methanamine， hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 500mg, 10g, 5g, 100mg, 250mg, 1g.
1H-benzimidazol-4-ylmethanamine;hydrochloride (CAS 1788044-02-9) is a chemical compound with the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. IUPAC name: 1H-benzimidazol-4-ylmethanamine;hydrochloride. InChIKey: ZPQMBEFIWCORAE-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3 |
|---|---|
| Molecular weight | 183.64 g/mol |
| IUPAC name | 1H-benzimidazol-4-ylmethanamine;hydrochloride |
| InChIKey | ZPQMBEFIWCORAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC=N2)CN.Cl |
Computed by PubChem (NCBI)