Products 1788054-73-8

CAS 1788054-73-8 is the registry number for Benzyl 1,6-diazaspiro[3.5]nonane-6-carboxylate hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Bis(benzyl 1,8-diazaspiro[3.5]nonane-8-carboxylate);oxalic acid (CAS 1788054-73-8) is a chemical compound with the molecular formula C32H42N4O8 and a molecular weight of 610.7 g/mol. IUPAC name: bis(benzyl 1,8-diazaspiro[3.5]nonane-8-carboxylate);oxalic acid. InChIKey: YPXBEQGVVHOQHW-UHFFFAOYSA-N.

Identity
Molecular formulaC32H42N4O8
Molecular weight610.7 g/mol
IUPAC namebis(benzyl 1,8-diazaspiro[3.5]nonane-8-carboxylate);oxalic acid
InChIKeyYPXBEQGVVHOQHW-UHFFFAOYSA-N
SMILESC1CC2(CCN2)CN(C1)C(=O)OCC3=CC=CC=C3.C1CC2(CCN2)CN(C1)C(=O)OCC3=CC=CC=C3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)