Products 2940960-33-6

CAS 2940960-33-6 appears in our catalog under these names: Benzyl 2,7-diazaspiro(4.4)nonane-2-carboxylate hemioxalate, 98%, benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate,hemi(oxalic acid), 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.

Bis(benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate);oxalic acid (CAS 2940960-33-6) is a chemical compound with the molecular formula C32H42N4O8 and a molecular weight of 610.7 g/mol. IUPAC name: bis(benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate);oxalic acid. InChIKey: CMSQMKQZYOGHCO-UHFFFAOYSA-N.

Identity
Molecular formulaC32H42N4O8
Molecular weight610.7 g/mol
IUPAC namebis(benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate);oxalic acid
InChIKeyCMSQMKQZYOGHCO-UHFFFAOYSA-N
SMILESC1CNCC12CCN(C2)C(=O)OCC3=CC=CC=C3.C1CNCC12CCN(C2)C(=O)OCC3=CC=CC=C3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)